Beschermde nucleosiden

Beschermde nucleosiden

  • C30H29FN2O7 uridine, 5′-O- [BIS (4-methoxyfenyl) fenylmethyl] -2′-deoxy-2′-fluoro- (9ci, aci)

    C30H29FN2O7 uridine, 5′-O- [BIS (4-methoxyfenyl) fenylmethyl] -2′-deoxy-2′-fluoro- (9ci, aci)

    Fysische eigenschappen sleutel fysische eigenschappen Waarde Conditie Molecuulgewicht 548,56 - Smeltpunt (experimenteel) 118-120 ° C - Dichtheid (voorspeld) 1,38 ± 0,1 g/cm3 Temp: 20 ° C; Press: 760 Torr pKa (Predicted) 9.39±0.10 Most Acidic Temp: 25 °C Other Names and Identifiers Canonical SMILES O=C1C=CN(C(=O)N1)C2OC(COC(C=3C=CC=CC3)(C4=CC=C(OC)C=C4)C5=CC=C(OC)C=C5)C(O)C2F Isomere glimlach c (oc [c@h] 1o [c@h] ([c@h] (f) [c @@ h] 1o) n2c (= o) nc (= o) c = c2) (c3 = cc = c (oc) c = c3) (c4 = cc = c (oc) c = c4) c5 = cc = cc = cc = cc = c5 ...
  • C31H30N2O7 6H-Furo[2′,3′:4,5]oxazolo[3,2-a]pyrimidin-6-one, 2-[[bis(4-methoxy phenyl)phenylmethoxy]methyl]-2,3,3a,9a-tetrahydro-3-hydroxy-7- methyl-, (2R,3R,3aS,9aR)- (9ci, ACI)

    C31H30N2O7 6H-Furo[2′,3′:4,5]oxazolo[3,2-a]pyrimidin-6-one, 2-[[bis(4-methoxy phenyl)phenylmethoxy]methyl]-2,3,3a,9a-tetrahydro-3-hydroxy-7- methyl-, (2R,3R,3aS,9aR)- (9ci, ACI)

    Fysische eigenschappen sleutel fysische eigenschappen Waarde Conditie Molecuulgewicht 542.58 - Kookpunt (voorspeld) 692,9 ± 65,0 ° C Pers: 760 Torr -dichtheid (voorspeld) 1,33 ± 0,1 g/cm3 temp: 20 ° C; Press: 760 Torr pKa (Predicted) 12.51±0.60 Most Acidic Temp: 25 °C Other Names and Identifiers Canonical SMILES O=C1N=C2OC3C(O)C(OC3N2C=C1C)COC(C=4C=CC=CC4)(C5=CC=C(OC)C=C5)C6=CC=C(OC)C=C6 Isomeric Smiles C (OC [C@H] 1o [C @@] 2 ([C@] ([C @@ H] 1o) (OC = 3N2C = C (C) C (= O) N3) [H]) [H]) (C4 = CC = C (OC) C = C4) (C5 = CC ...
  • C33H35N3O8 cytidine, N-acetyl-5′-O- [BIS (4-methoxyfenyl) fenylmethyl] -2′-O- methyl- (9ci, aci)

    C33H35N3O8 cytidine, N-acetyl-5′-O- [BIS (4-methoxyfenyl) fenylmethyl] -2′-O- methyl- (9ci, aci)

    Fysische eigenschappen sleutel fysische eigenschappen Waarde Conditie Molecuulgewicht 601,65 - Dichtheid (voorspeld) 1,28 ± 0,1 g/cm3 Temp: 20 ° C; Druk op: 760 TORR PKA (voorspelde) 10,19 ± 0,20 meest zure temperatuur: 25 ° C andere namen en identificatiegegevens canonieke glimlachen O = C1N = C (C = CN1C2OC (COC (C = 3C = CC = CC3) (C4 = CC = C (OC) C = C4) C5 = CC = C (OC) C = C5) C (O) C2OC) NC (= O) C isomere glimlach C (OC [C@H] 1o [C@H] ([C@H] (OC) [C @@ H] 1o) N2C (= O) N = C (NC (C) = O) C = C2) (C3 = CC = C (OC) C = C3) (C4 = CC = C (OC) C = C4) C5 = CC = CC = CC = CC = CC = CC = CC = CC = CC = CC = CC = C5 Inchi Inchi = 1S/C33H35N3O8/C1-2 ...
  • C31H32N2O8 uridine, 5′-O- [BIS (4-methoxyfenyl) fenylmethyl] -2′-O-methyl- (9C I, ACI)

    C31H32N2O8 uridine, 5′-O- [BIS (4-methoxyfenyl) fenylmethyl] -2′-O-methyl- (9C I, ACI)

    Fysische eigenschappen sleutel fysische eigenschappen waarde conditie molecuulgewicht 560,60 - dichtheid (voorspeld) 1,35 ± 0,1 g/cm3 temp: 20 ° C; Press: 760 Torr pKa (Predicted) 9.39±0.10 Most Acidic Temp: 25 °C Other Names and Identifiers Canonical SMILES O=C1C=CN(C(=O)N1)C2OC(COC(C=3C=CC=CC3)(C4=CC=C(OC)C=C4)C5=CC=C(OC)C=C5)C(O)C2OC Isomere glimlach c (oc [c@h] 1o [c@h] ([c@h] (oc) [c @@ h] 1o) n2c (= o) nc (= o) c = c2) (c3 = cc = c (oc) c = c3) (c4 = cc = c (oc) c = c4) c5 = cc = cc = cc = cc = c5 inchi Inchi = 1S/C31H32N2O8/C1-37-23-13-9-2 ...
  • C30H28N2O7 6H-Furo[2′,3′:4,5]oxazolo[3,2-a]pyrimidin-6-one, 2-[[bis(4-methoxy phenyl)phenylmethoxy]methyl]-2,3,3a,9a-tetrahydro-3-hydroxy-, (2R,3R,3aS,9aR)- (9CI, ACI)

    C30H28N2O7 6H-Furo[2′,3′:4,5]oxazolo[3,2-a]pyrimidin-6-one, 2-[[bis(4-methoxy phenyl)phenylmethoxy]methyl]-2,3,3a,9a-tetrahydro-3-hydroxy-, (2R,3R,3aS,9aR)- (9CI, ACI)

    Fysische eigenschappen sleutel fysische eigenschappen Waarde Conditie Molecuulgewicht 528.55 - Smeltpunt (experimenteel) 129.5-130 ° C - kookpunt (voorspeld) 688,2 ± 65,0 ° C Pers: 760 Torr -dichtheid (voorspeld) 1,35 ± 0,1 g/cm3 temp: 20 ° C; Druk op: 760 Torr PKA (voorspeld) 12,51 ± 0,40 Meest zure temperatuur: 25 ° C Andere namen en identificatiegegevens Canonical Smiles O = C1N = C2OC3C (O) C (OC3N2C = C1) COC (C6 Isomeric Smiles (OC) C6 = C5) C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C5) C6 = C5) C6 = C6 = C6 = C6 = C5) C6 = C5) C6 = C6 = C6 = C6 = C5) C6 = C5). C (OC [C@H] 1O [C @@] 2 ([C@] ([C @@ H] 1o) (OC = 3N2 ...
  • C36H39N5O8 guanosine, 5′-O- [BIS (4-methoxyfenyl) fenylmethyl] -2′-O-methyl- N- (2-methyl-1-oxopropyl)-(9ci, ACI)

    C36H39N5O8 guanosine, 5′-O- [BIS (4-methoxyfenyl) fenylmethyl] -2′-O-methyl- N- (2-methyl-1-oxopropyl)-(9ci, ACI)

    Fysische eigenschappen sleutel fysische eigenschappen Waarde Conditie Molecuulgewicht 669.72 - Dichtheid (voorspeld) 1,35 ± 0,1 g/cm3 Temp: 20 ° C; Druk op: 760 Torr PKA (voorspeld) 9,16 ± 0,20 Meest zure temperatuur: 25 ° C Andere namen en identificatiegegevens canonieke glimlachen O = C1N = C (NC (= O) C (C) C) NC2 = C1N = CN2C3OC (COC (C = 4C = CC = CC4) (C5 = CC = C (OC) C = C5) C6 = CC = C (OC) C = C6) C (O) C3OC ESOMEISCHE SMILES SMILES SMILES SMILES SMILES SMILES SMILES. C (OC [C@H] 1O [C@H] ([C@H] (OC) [C @@ H] 1o) N2C3 = C (N = C2) C (= O) N = C (NC (C (C) C) = O) N3) (C4 = CCIn = C (OC) C = C4) (C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5)
  • C15H21N5O6 guanosine, 2′-O-methyl-N- (2-methyl-1-oxopropyl)-(9ci, ACI)

    C15H21N5O6 guanosine, 2′-O-methyl-N- (2-methyl-1-oxopropyl)-(9ci, ACI)

    Fysische eigenschappen sleutel fysische eigenschappen waarde conditie molecuulgewicht 367.36 - dichtheid (voorspeld) 1,68 ± 0,1 g/cm3 temp: 20 ° C; Druk op: 760 Torr PKA (voorspeld) 9,16 ± 0,20 Meest zure temperatuur: 25 ° C Andere namen en identificatiegegevens Canonieke glimlachen O = C1N = C (NC (= O) C (C) C) NC2 = C1N = CN2C3OC (CO) C (O) C3OC ISOMEISCHE SMILES SMILES SMILES SMILES SMILES SMILES SMILES SMILES. O (C) [C@H] 1 [C@H] (N2C3 = C (N = C2) C (= O) N = C (NC (C (C) C) = O) N3) O [C@H] (CO) [C@H] 1O inchi Inchi = 1S/C15H21N5O6/C1-6 (2) 12 (23) 18-15-17-11-8 (13 (24) 19-15) 16-5-20 (11) 14-10 (25-3) 9 (22) 7 (4-21) 26-...
  • C39H37N5O7 adenosine, N-benzoyl-5′-O- [bis (4-methoxyfenyl) fenylmethyl] -2′- O-methyl- (9ci, aci)

    C39H37N5O7 adenosine, N-benzoyl-5′-O- [bis (4-methoxyfenyl) fenylmethyl] -2′- O-methyl- (9ci, aci)

    Fysische eigenschappen sleutel fysische eigenschappen Waarde Conditie Molecuulgewicht 687.74 - Dichtheid (voorspeld) 1,32 ± 0,1 g/cm3 Temp: 20 ° C; Druk op: 760 Torr PKA (voorspelde) 7,87 ± 0,43 meest zure temperatuur: 25 ° C andere namen en identificatiegegevens canonieke glimlachen O = C (NC1 = NC = NC2 = C1N = CN2C3OC (COC (C = 4C = CC = CC4) (C5 = CC = C (OC) C = C5) C6 = CC = C (OC) C = C6) C (O) C3OC) C = 7C = CC = CC7 Isomerische Smiles Smiles Smiles Smiles C(OC[C@H]1O[C@H]([C@H](OC)[C@@H]1O)N2C=3C(N=C2)=C(NC(=O)C4=CC=CC=C4)N=CN3)(C5=CC=C(OC)C=C5)(C6=CC=C(OC)C=C6) C7=CC=CC=C7 In...