Producten

Producten

  • C30H30N2O8 uridine, 5′-O- [bis (4-methoxyfenyl) fenylmethyl]-(9ci, aci)

    C30H30N2O8 uridine, 5′-O- [bis (4-methoxyfenyl) fenylmethyl]-(9ci, aci)

    Fysische eigenschappen sleutel fysische eigenschappen Waarde Conditie molecuulgewicht 546.57 - smeltpunt (experimenteel) 111-112 ° C oplosmiddel: ethylacetaatdichtheid (voorspeld) 1.343 ± 0,06 g/cm3 temp: 20 ° C; Press: 760 Torr pKa (Predicted) 9.39±0.10 Most Acidic Temp: 25 °C Other Names and Identifiers Canonical SMILES O=C1C=CN(C(=O)N1)C2OC(COC(C=3C=CC=CC3)(C4=CC=C(OC)C=C4)C5=CC=C(OC)C=C5)C(O)C2O Isomere glimlach c (oc [c@h] 1o [c@h] ([c@h] (o) [c @@ h] 1o) n2c (= o) nc (= o) c = c2) (c3 = cc = c (oc) c = c3) (c4 = c ...
  • C41H51N5O8SI guanosine, 5′-O- [BIS (4-methoxyfenyl) fenylmethyl] -2′-O-[(1,1-dimethylethyl) dimethylsilyl] -N- (2-methyl-1-oxopropyl)-(9ci, aci)

    C41H51N5O8SI guanosine, 5′-O- [BIS (4-methoxyfenyl) fenylmethyl] -2′-O-[(1,1-dimethylethyl) dimethylsilyl] -N- (2-methyl-1-oxopropyl)-(9ci, aci)

    Fysische eigenschappen sleutel fysische eigenschappen Waarde Conditie Molecuulgewicht 769,96 - Dichtheid (voorspeld) 1,25 ± 0,1 g/cm3 Temp: 20 ° C; Druk op: 760 Torr PKA (voorspeld) 9,16 ± 0,20 Meest zure temperatuur: 25 ° C Andere namen en identificatiegegevens canonieke glimlachen O=C1N=C(NC(=O)C(C)C)NC2=C1N=CN2C3OC(COC(C=4C=CC=CC4)(C5=CC=C(OC)C=C5)C6=CC=C(OC)C=C6)C(O)C3O[Si](C)(C)C(C)(C)C Isomeric SMILES C (OC [C@H] 1O [C@H] ([C@H] (O [Si] (C (C) (C) C) (C) (C) C) [C @@ H] 1o) N2C3 = C (N = C2) C (= O) N = C (NC (C (C) C) = O) N3) (C4 = CC = C (OC) C (OC) C4 = ...
  • C44H49N5O7SI adenosine, N-benzoyl-5′-O- [BIS (4-methoxyfenyl) fenylmethyl] -2′-O-[(1,1-dimethylethyl) dimethylsilyl]-(9ci, aci)

    C44H49N5O7SI adenosine, N-benzoyl-5′-O- [BIS (4-methoxyfenyl) fenylmethyl] -2′-O-[(1,1-dimethylethyl) dimethylsilyl]-(9ci, aci)

    Fysische eigenschappen sleutel fysische eigenschappen Waarde Conditie Molecuulgewicht 787.98 - Dichtheid (voorspeld) 1,23 ± 0,1 g/cm3 Temp: 20 ° C; Druk op: 760 Torr PKA (voorspelde) 7,87 ± 0,43 meest zure temperatuur: 25 ° C andere namen en identificatiegegevens canonieke glimlachen O=C(NC1=NC=NC2=C1N=CN2C3OC(COC(C=4C=CC=CC4)(C5=CC=C(OC)C=C5)C6=CC=C(OC)C=C6)C(O)C3O[Si](C)(C)C(C)(C)C)C=7C=CC= CC7 Isomeric SMILES C (OC [C@H] 1O [C@H] ([C@H] (O [Si] (C (C) (C) C) (C) C) [C @@ H] 1o) N2C = 3C (N = C2) = C (NC (= O) C4 = CC = CC = CC = C4) N = CN3) (C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5)
  • C17H17N5O5 Adenosine, N-Benzoyl- (7CI, 9CI, ACI) H333, H303, H302

    C17H17N5O5 Adenosine, N-Benzoyl- (7CI, 9CI, ACI) H333, H303, H302

    Physical properties Key Physical Properties Value Condition Molecular Weight 371.35 - Melting Point (Experimental) 152 °C - Density (Predicted) 1.70±0.1 g/cm3 Temp: 20 °C; Press: 760 Torr pKa (Predicted) 7.87±0.43 Most Acidic Temp: 25 °C Other Names and Identifiers Canonical SMILES O=C(NC1=NC=NC2=C1N=CN2C3OC(CO)C(O)C3O)C=4C=CC=CC4 Isomeric SMILES O [C@H] 1 [C@H] (N2C = 3C (N = C2) = C (NC (= O) C4 = CC = CC = C4) N = CN3) O [C@H] (Co) [C@H] 1o inchi Inchi = 1S/C17N5O5/C23-6-10-12 (24) 13 (25) (25) (25) (25) (25) (25) (25) (25) (25) (25) (25) (25) (25) (25) (25) (25) (25) (25) (25) (25) (25) (25) (25) (25) (25) (25) (25) (25) (27-10)) 22-8 ...
  • C41H43N3O9 Cytidine, N-Benzoyl-5′-O- [BIS (4-methoxyfenyl) fenylmethyl] -2′-O- (2-methoxyethyl) -5-methyl- (9CI, ACI) H335, H319, H315, H315

    C41H43N3O9 Cytidine, N-Benzoyl-5′-O- [BIS (4-methoxyfenyl) fenylmethyl] -2′-O- (2-methoxyethyl) -5-methyl- (9CI, ACI) H335, H319, H315, H315

    Fysische eigenschappen sleutel fysische eigenschappen Waarde Conditie Molecuulgewicht 721,80 - Smeltpunt (experimenteel) 107-110 ° C - Dichtheid (voorspeld) 1,26 ± 0,1 g/cm3 Temp: 20 ° C; Druk op: 760 Torr PKA (voorspelde) 8,60 ± 0,40 meest zure temperatuur: 25 ° C andere namen en identificatiegegevens canonieke glimlachen O = C1N = C (NC (= O) C = 2C = CC = CC2) C (= CN1C3OC (COC (C = 4C = CC = CC4) (C5 = CC = C (OC) C = C5) C6 = CC = C (OC) C = C6) C (O) C3coccoc) C 3cococ) C 3COCCOC -SMILES SMILES SMILES SMILES SMILES SMILES C (OC [C@H] 1O [C@H] ([C@H] (Occoc) [C @@ H] 1o) N2C (= O) N = C (NC (= O) C3 = CC = CC = CC = C3) C (C) = C2) (...
  • C34H39N3O8 cytidine, 5′-O- [BIS (4-methoxyfenyl) fenylmethyl] -2′-O- (2-methox yethyl) -5-methyl- (9ci, aci)

    C34H39N3O8 cytidine, 5′-O- [BIS (4-methoxyfenyl) fenylmethyl] -2′-O- (2-methox yethyl) -5-methyl- (9ci, aci)

    Fysische eigenschappen sleutel fysische eigenschappen Waarde Conditie Molecuulgewicht 617.69 - kookpunt (voorspeld) 762,6 ± 70,0 ° C Pers: 760 Torr -dichtheid (voorspeld) 1,27 ± 0,1 g/cm3 temp: 20 ° C; Druk op: 760 Torr PKA (voorspeld) 13,31 ± 0,70 meest zure temperatuur: 25 ° C andere namen en identificatiegegevens canonieke glimlachen O = C1N = C (N) C (= CN1C2OC (COC (C = 3C = CC = CC3) (C4 = CC = C (OC) C = C4) C5 = CC = C (OC) C = C5) C (O) C2occoc) C isomere glimlach C (OC [C@H] 1O [C@H] ([C@H] (Occoc) [C @@ H] 1o) N2C (= O) N = C (N) C (C) = C2) (C3 = CC = C (OC) C = C3) (...
  • C17H25N5O7 guanosine, 2′-O- (2-methoxyethyl) -N- (2-methyl-1-oxopropyl)-(9ci, een CI)

    C17H25N5O7 guanosine, 2′-O- (2-methoxyethyl) -N- (2-methyl-1-oxopropyl)-(9ci, een CI)

    Fysische eigenschappen sleutel fysische eigenschappen Waarde Conditie Molecuulgewicht 411.41 - Smeltpunt (experimenteel) 137-139.2 ° C - Dichtheid (voorspeld) 1,60 ± 0,1 g/cm3 Temp: 20 ° C; Druk op: 760 Torr PKA (voorspeld) 8,68 ± 0,20 Meest zure temperatuur: 25 ° C Andere namen en identificatiegegevens Canonieke glimlachen O = C1N = C (NC (= O) C (C) C) NC2 = C1N = CN2C3OC (CO) C (O) C3OCCOC ISOMICISCHE SMILES SMILES SMILES SMILES SMESOMERISCH O = C1C2 = C (N (C = N2) [C@H] 3 [C@H] (OccoC) [C@H] (O) [C @@ H] (Co) O3) NC (NC (C (C) C) = O) = N1 inchi inchi = 1S/C17H25N5O7/C1-8 (2) 14 (25) 20-17-19-19-19-19-19-19-19-19-19-19-19-19-19-19-19-19-19-19-19-19e.
  • C41H41N5O8 adenosine, N-benzoyl-5′-O- [bis (4-methoxyfenyl) fenylmethyl] -2′- O- (2-methoxyethyl)-(9ci, aci)

    C41H41N5O8 adenosine, N-benzoyl-5′-O- [bis (4-methoxyfenyl) fenylmethyl] -2′- O- (2-methoxyethyl)-(9ci, aci)

    Fysische eigenschappen sleutel fysische eigenschappen Waarde Conditie Molecuulgewicht 731.79 - Smeltpunt (experimenteel) 119-121 ° C - Dichtheid (voorspeld) 1,31 ± 0,1 g/cm3 Temp: 20 ° C; Druk op: 760 Torr PKA (voorspelde) 7,87 ± 0,43 meest zure temperatuur: 25 ° C andere namen en identificatiegegevens canonieke glimlachen O = C (NC1 = NC = NC2 = C1N = CN2C3OC (COC (C = 4C = CC = CC4) (C5 = CC = C (OC) C = C5) C6 = CC = C (OC) C = C6) C (O) C3occoc) C = 7C = CC = CC7 Isoomerisch Smiles Smiles Smiles C (OC [C@H] 1o [C@H] ([C@H] (Occoc) [C @@ H] 1o) N2C = 3C (N = C2) = C (NC (= O) C4 = CC = CC = CC = C4) N = CN3 ...
  • C20H23N5O6 Adenosine, N-Benzoyl-2′-O- (2-methoxyethyl)-(9ci, ACI)

    C20H23N5O6 Adenosine, N-Benzoyl-2′-O- (2-methoxyethyl)-(9ci, ACI)

    Fysische eigenschappen sleutel fysische eigenschappen Waarde Conditie Molecuulgewicht 429.43 - Dichtheid (voorspeld) 1,53 ± 0,1 g/cm3 Temp: 20 ° C; Druk op: 760 Torr PKA (voorspeld) 13,15 ± 0,70 Meest zure temperatuur: 25 ° C andere namen en identificatiegegevens canonieke glimlachen o = c (nc1 = nc = nc2 = c1n = cn2c3oc (Co) c (o) c3cocc) c = 4c = 4c = cc = cc4 isoomerische smile smiles O (CCOC) [C@H] 1 [C @@ H] (O [C@H] (CO) [C@H] 1o) N2C = 3C (N = C2) = C (NC (= O) C4 = CC = CC = CC = C4) N = CN3 Inchi Inchi = 1S/C20H23N5O6/C1-29-7-8-30-16-15 (27) 13 (9-26) 31-20 (16) 25-11-23-14-17 (21-10-22 ...
  • C42H39N3O8 nog niet toegewezen

    C42H39N3O8 nog niet toegewezen

    Fysische eigenschappen sleutel fysische eigenschappen Waarde Conditie Molecuulgewicht 713.78 - Dichtheid (voorspeld) 1,315 ± 0,06 g/cm3 Temp: 20 ° C; Druk op: 760 Torr PKA (voorspeld) 8,23 ± 0,10 Meest zure temperatuur: 25 ° C Andere namen en identificatiegegevens canonieke glimlachen O = C1NC (= O) N (C = C1C (= O) NCC2 = CC = CC = 3C = CC = CC32) C4OC (COC (C = 5C = CC = CC5) (C6 = CC = C (OC) C = C6) C7 = CC = C (OC) C = C7) C (O) C4 C7) C (O) C4 C7) C4) C4 C7) C (O) C4 C7) C (O) C4) C4 -isomeer Smiles C (OC [C@H] 1o [C@H] (C [C @@ H] 1o) N2C = C (NCC = 3C4 = C (C = CC3) C = CC = C4) = O) C (= O) NC2 = O) (C5 = CC = C (OC) C = C5) (C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = ...
  • C38H37N3O8 nog niet toegewezen

    C38H37N3O8 nog niet toegewezen

    Fysische eigenschappen sleutel fysische eigenschappen Waarde Conditie Molecuulgewicht 663.72 - Dichtheid (voorspeld) 1,304 ± 0,06 g/cm3 Temp: 20 ° C; Druk op: 760 Torr PKA (voorspelde) 8,27 ± 0,10 Meest zure temperatuur: 25 ° C Andere namen en identificatiegegevens canonieke glimlachen O = C1NC (= O) N (C = C1C (= O) NCC = 2C = CC = CC2) C3OC (COC (C = 4C = CC = CC4) (C5 = CC = C (OC) C = C5) C6 = C (OC) C = C6) C (O) C3 C3 is. C (OC [C@H] 1o [C@H] (C [C @@ H] 1o) N2C = C (C (NCC3 = CC = CC = C3) = O) C (= O) NC2 = O) (C4 = CC = C (OC) C = C4) (C5 = C (OC) C = C5) C6 = C5) C6 = C5) C6 = CC = CC = CC = C 6 INC ...
  • C30H29FN2O7 uridine, 5′-O- [BIS (4-methoxyfenyl) fenylmethyl] -2′-deoxy-2′-fluoro- (9ci, aci)

    C30H29FN2O7 uridine, 5′-O- [BIS (4-methoxyfenyl) fenylmethyl] -2′-deoxy-2′-fluoro- (9ci, aci)

    Fysische eigenschappen sleutel fysische eigenschappen Waarde Conditie Molecuulgewicht 548,56 - Smeltpunt (experimenteel) 118-120 ° C - Dichtheid (voorspeld) 1,38 ± 0,1 g/cm3 Temp: 20 ° C; Press: 760 Torr pKa (Predicted) 9.39±0.10 Most Acidic Temp: 25 °C Other Names and Identifiers Canonical SMILES O=C1C=CN(C(=O)N1)C2OC(COC(C=3C=CC=CC3)(C4=CC=C(OC)C=C4)C5=CC=C(OC)C=C5)C(O)C2F Isomere glimlach c (oc [c@h] 1o [c@h] ([c@h] (f) [c @@ h] 1o) n2c (= o) nc (= o) c = c2) (c3 = cc = c (oc) c = c3) (c4 = cc = c (oc) c = c4) c5 = cc = cc = cc = cc = c5 ...