-
![C31H32N2O8 uridine, 5′-O- [BIS (4-methoxyfenyl) fenylmethyl] -2′-O-methyl- (9C I, ACI)](https://cdn.globalso.com/nvchem/C31H32N2O8-Uridine.jpg)
C31H32N2O8 uridine, 5′-O- [BIS (4-methoxyfenyl) fenylmethyl] -2′-O-methyl- (9C I, ACI)
Fysische eigenschappen sleutel fysische eigenschappen waarde conditie molecuulgewicht 560,60 - dichtheid (voorspeld) 1,35 ± 0,1 g/cm3 temp: 20 ° C; Press: 760 Torr pKa (Predicted) 9.39±0.10 Most Acidic Temp: 25 °C Other Names and Identifiers Canonical SMILES O=C1C=CN(C(=O)N1)C2OC(COC(C=3C=CC=CC3)(C4=CC=C(OC)C=C4)C5=CC=C(OC)C=C5)C(O)C2OC Isomere glimlach c (oc [c@h] 1o [c@h] ([c@h] (oc) [c @@ h] 1o) n2c (= o) nc (= o) c = c2) (c3 = cc = c (oc) c = c3) (c4 = cc = c (oc) c = c4) c5 = cc = cc = cc = cc = c5 inchi Inchi = 1S/C31H32N2O8/C1-37-23-13-9-2 ... -
![C30H28N2O7 6H-Furo[2′,3′:4,5]oxazolo[3,2-a]pyrimidin-6-one, 2-[[bis(4-methoxy phenyl)phenylmethoxy]methyl]-2,3,3a,9a-tetrahydro-3-hydroxy-, (2R,3R,3aS,9aR)- (9CI, ACI)](https://cdn.globalso.com/nvchem/C30H28N2O7-6H-Furo.jpg)
C30H28N2O7 6H-Furo[2′,3′:4,5]oxazolo[3,2-a]pyrimidin-6-one, 2-[[bis(4-methoxy phenyl)phenylmethoxy]methyl]-2,3,3a,9a-tetrahydro-3-hydroxy-, (2R,3R,3aS,9aR)- (9CI, ACI)
Fysische eigenschappen sleutel fysische eigenschappen Waarde Conditie Molecuulgewicht 528.55 - Smeltpunt (experimenteel) 129.5-130 ° C - kookpunt (voorspeld) 688,2 ± 65,0 ° C Pers: 760 Torr -dichtheid (voorspeld) 1,35 ± 0,1 g/cm3 temp: 20 ° C; Druk op: 760 Torr PKA (voorspeld) 12,51 ± 0,40 Meest zure temperatuur: 25 ° C Andere namen en identificatiegegevens Canonical Smiles O = C1N = C2OC3C (O) C (OC3N2C = C1) COC (C6 Isomeric Smiles (OC) C6 = C5) C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C6 = C5) C6 = C5) C6 = C6 = C6 = C6 = C5) C6 = C5) C6 = C6 = C6 = C6 = C5) C6 = C5). C (OC [C@H] 1O [C @@] 2 ([C@] ([C @@ H] 1o) (OC = 3N2 ... -
![C36H39N5O8 guanosine, 5′-O- [BIS (4-methoxyfenyl) fenylmethyl] -2′-O-methyl- N- (2-methyl-1-oxopropyl)-(9ci, ACI)](https://cdn.globalso.com/nvchem/C36H39N5O8-Guanosine.jpg)
C36H39N5O8 guanosine, 5′-O- [BIS (4-methoxyfenyl) fenylmethyl] -2′-O-methyl- N- (2-methyl-1-oxopropyl)-(9ci, ACI)
Fysische eigenschappen sleutel fysische eigenschappen Waarde Conditie Molecuulgewicht 669.72 - Dichtheid (voorspeld) 1,35 ± 0,1 g/cm3 Temp: 20 ° C; Druk op: 760 Torr PKA (voorspeld) 9,16 ± 0,20 Meest zure temperatuur: 25 ° C Andere namen en identificatiegegevens canonieke glimlachen O = C1N = C (NC (= O) C (C) C) NC2 = C1N = CN2C3OC (COC (C = 4C = CC = CC4) (C5 = CC = C (OC) C = C5) C6 = CC = C (OC) C = C6) C (O) C3OC ESOMEISCHE SMILES SMILES SMILES SMILES SMILES SMILES SMILES. C (OC [C@H] 1O [C@H] ([C@H] (OC) [C @@ H] 1o) N2C3 = C (N = C2) C (= O) N = C (NC (C (C) C) = O) N3) (C4 = CCIn = C (OC) C = C4) (C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5 = C5) -
C15H21N5O6 guanosine, 2′-O-methyl-N- (2-methyl-1-oxopropyl)-(9ci, ACI)
Fysische eigenschappen sleutel fysische eigenschappen waarde conditie molecuulgewicht 367.36 - dichtheid (voorspeld) 1,68 ± 0,1 g/cm3 temp: 20 ° C; Druk op: 760 Torr PKA (voorspeld) 9,16 ± 0,20 Meest zure temperatuur: 25 ° C Andere namen en identificatiegegevens Canonieke glimlachen O = C1N = C (NC (= O) C (C) C) NC2 = C1N = CN2C3OC (CO) C (O) C3OC ISOMEISCHE SMILES SMILES SMILES SMILES SMILES SMILES SMILES SMILES. O (C) [C@H] 1 [C@H] (N2C3 = C (N = C2) C (= O) N = C (NC (C (C) C) = O) N3) O [C@H] (CO) [C@H] 1O inchi Inchi = 1S/C15H21N5O6/C1-6 (2) 12 (23) 18-15-17-11-8 (13 (24) 19-15) 16-5-20 (11) 14-10 (25-3) 9 (22) 7 (4-21) 26-... -
![C39H37N5O7 adenosine, N-benzoyl-5′-O- [bis (4-methoxyfenyl) fenylmethyl] -2′- O-methyl- (9ci, aci)](https://cdn.globalso.com/nvchem/Substance-Detail.jpg)
C39H37N5O7 adenosine, N-benzoyl-5′-O- [bis (4-methoxyfenyl) fenylmethyl] -2′- O-methyl- (9ci, aci)
Fysische eigenschappen sleutel fysische eigenschappen Waarde Conditie Molecuulgewicht 687.74 - Dichtheid (voorspeld) 1,32 ± 0,1 g/cm3 Temp: 20 ° C; Druk op: 760 Torr PKA (voorspelde) 7,87 ± 0,43 meest zure temperatuur: 25 ° C andere namen en identificatiegegevens canonieke glimlachen O = C (NC1 = NC = NC2 = C1N = CN2C3OC (COC (C = 4C = CC = CC4) (C5 = CC = C (OC) C = C5) C6 = CC = C (OC) C = C6) C (O) C3OC) C = 7C = CC = CC7 Isomerische Smiles Smiles Smiles Smiles C(OC[C@H]1O[C@H]([C@H](OC)[C@@H]1O)N2C=3C(N=C2)=C(NC(=O)C4=CC=CC=C4)N=CN3)(C5=CC=C(OC)C=C5)(C6=CC=C(OC)C=C6) C7=CC=CC=C7 In... -
C13H19N5O6 guanosine, 2 '-o- (2-methoxyethyl)-(9ci, ACI)
Substantie Detail CAS-registernummer 473278-54-5 Sleutel Fysische eigenschappen Waarde Conditie Molecuulgewicht 341.32-Kookpunt (voorspeld) 715,0 ± 70,0 ° C Pers: 760 Torr-dichtheid (voorspeld) 1,81 ± 0,1 g/cm3 temp: 20 ° C; Druk op: 760 Torr PKA (voorspeld) 13,20 ± 0,70 meest zure temperatuur: 25 ° C andere namen en identificatiegegevens canonieke glimlachen o = C1N = C (n) nc2 = C1N = CN2C3OC (CO) C (O) C3cocc -isomere glimlach O (CCOC) [C@H] 1 [C @@ H] (O [C@H] (CO) [C@H] 1o) N2C3 = C (N = C2) C (= O) N = C (N) N3 Inchi = 1S/C13H19N5O6/... -
C13H19N5O5 adenosine, 2 '-o- (2-methoxyethyl)-(9ci, ACI)
Substantie Detail CAS-registernummer 168427-74-5 Key Fysieke eigenschappen Waarde Conditie Molecuulgewicht 325.32-Kookpunt (voorspeld) 639,0 ± 65,0 ° C Pers: 760 Torr-dichtheid (voorspeld) 1,70 ± 0,1 g/cm3 temp: 20 ° C; Druk op: 760 Torr PKA (voorspeld) 13,12 ± 0,70 meest zure temperatuur: 25 ° C Andere namen en identificatiegegevens canonieke glimlachen OCC1OC (N2C = NC = 3C (= NC = NC32) N) C (Occoc) C1O -isomere glimlach O (CCOC) [C@H] 1 [C @@ H] (O [C@H] (CO) [C@H] 1o) N2C = 3C (N = C2) = C (N) N = CN3 Inchi Inchi = 1S/C13H19N5O5/C ... -
![C21H21N3O6 thymidine, α- [(1-naftalenylmethyl) amino]- α -oxo- (aci)](https://cdn.globalso.com/nvchem/C21H21N3O6-Thymidine.png)
C21H21N3O6 thymidine, α- [(1-naftalenylmethyl) amino]- α -oxo- (aci)
Substantie detail CAS-registernummer 1262015-90-6 Key Fysieke eigenschappen Waarde Conditie Molecuulgewicht 411.41-Dichtheid (voorspeld) 1,460 ± 0,06 g/cm3 Temp: 20 ° C; Druk op: 760 Torr PKA (voorspeld) 8.23 ± 0,10 Meest zure temperatuur: 25 ° C Andere namen en identificatiegegevens Canonical Smiles O = C1NC (= O) N (C = C1C (= O) NCC2 = CC = CC = 3C = CC32) C4OC (CO) C (CO) C (O) C4 -isomeer Smiles O = C1N (C = C (C (NCC = 2C3 = C (C = CC2) C = CC = C3) = O) C (= O) N1) [C @@ H] 4O [C@H] (CO) [C @@ H] (O) C4 inchi = 1S/C21H21N3O6/C25-17-16 (26) 8-18 (26) 8-18 (26) 8-18 (26) 8-18 (26) 8-18 (26) 8-18 (26) -
![C17H19N3O6 thymidine, a -oxo- α - [(fenylmethyl) amino] - (ACI)](https://cdn.globalso.com/nvchem/C17H19N3O6-Thymidine.png)
C17H19N3O6 thymidine, a -oxo- α - [(fenylmethyl) amino] - (ACI)
Staatsdetail CAS-registernummer 944268-75-1 Sleutel Fysieke eigenschappen Waarde Conditie Molecuulgewicht 361,35-Dichtheid (voorspeld) 1,459 ± 0,06 g/cm3 Temp: 20 ° C; Druk op: 760 Torr PKA (voorspeld) 8,27 ± 0,10 Meest zure temperatuur: 25 ° C Andere namen en identificatiegegevens Canonieke glimlachen O = C1NC (= O) N (C = C1C (= O) NCC = 2C = CC = CC2) C3OC (CO) C (O) C3 C3 C3 C3 C3 -SMILES SMILES O = c1n ([c @@ h] 2o [c@h] (co) [c @@ h] (o) c2) c = c (c (ncc3 = cc = cc = c3) = o) c (= o) n1 inchi inchi = 1s/c17h19n3o6/c21-9-13-12 (22) 6-14 (26-20-20-20-20-20-8 -
C9H11FN2O5 uridine, 2 ′ -deoxy -2 ′ -fluoro- (7ci, 8ci, 9ci, aci)
Substantie Detail CAS-registernummer 784-71-4 H228 Key Fysieke eigenschappen Waarde Conditie Molecuulgewicht 246.19-Smeltpunt (experimenteel) 149-150 ° C-Dichtheid (voorspeld) 1,63 ± 0,1 g/cm3 temp: 20 ° C; Druk op: 760 Torr PKA (voorspeld) 9,39 ± 0,10 Meest zure temperatuur: 25 ° C Andere namen en identificatiegegevens Canonieke glimlach o = C1C = CN (C (= O) N1) C2OC (CO) C (O) C2F Isomere Smiles F [C@H] 1 [C @@ H] (O [C@H] (CO) [C@H] 1o) N2C (= O) NC (= O) C = C2 inchi inchi = 1S/C9H11FN2O5/C10-6-7 (15) 4 (3-13) 17-8 (6) 12-2-1-5 (1 ... -
![C10H12N2O5 6H-Furo [2 ′, 3 ′: 4,5] Oxazolo [3,2-A] Pyrimidin-6-One, 2,3,3a, 9a-Tetrah Ydro-3-Hydroxy-2- (Hydroxymethyl) -7-Methyl-, (2r, 3 R, 3AS, 9Ar)-9Ar, 9CI, Aci)](https://cdn.globalso.com/nvchem/C10H12N2O5-6H-Furo.jpg)
C10H12N2O5 6H-Furo [2 ′, 3 ′: 4,5] Oxazolo [3,2-A] Pyrimidin-6-One, 2,3,3a, 9a-Tetrah Ydro-3-Hydroxy-2- (Hydroxymethyl) -7-Methyl-, (2r, 3 R, 3AS, 9Ar)-9Ar, 9CI, Aci)
Staatsdetail CAS-registernummer 22423-26-3 Key Fysieke eigenschappen Waarde Conditie Molecuulgewicht 240.21-Smeltpunt (experimenteel) 218 ° C Oplosmiddel: ethanol; Isopropanol kookpunt (voorspeld) 452,0 ± 55,0 ° C Press: 760 torr -dichtheid (voorspeld) 1,88 ± 0,1 g/cm3 temp: 20 ° C; Press: 760 Torr pKa (Predicted) 12.56±0.60 Most Acidic Temp: 25 °C Other Names and Identifiers Canonical SMILES O=C1N=C2OC3C(O)C(OC3N2C=C1C)CO Isomeric SMILES O[C@H]1[C@]2([C@](N3C(O2)= NC(=O)C... -
![C9H10N2O5 6H-Furo [2 ′, 3 ′: 4,5] Oxazolo [3,2-a] Pyrimidin-6-ON, 2,3,3a, 9a-tetrah ydro-3-3-hydroxy-2- (hydroxymethyl)-, (2r, 3 r, 3aR)-(9CI, Aci)-Aci)](https://cdn.globalso.com/nvchem/C9H10N2O5-6H-Furo.png)
C9H10N2O5 6H-Furo [2 ′, 3 ′: 4,5] Oxazolo [3,2-a] Pyrimidin-6-ON, 2,3,3a, 9a-tetrah ydro-3-3-hydroxy-2- (hydroxymethyl)-, (2r, 3 r, 3aR)-(9CI, Aci)-Aci)
Substantie Detail CAS-registernummer 3736-77-4 Sleutel Fysische eigenschappen Waarde Conditie Molecuulgewicht 226.19-Smeltpunt (experimenteel) 234-235 ° C-kookpunt (voorspeld) 456.3 ± 55,0 ° C Pers: 760 Torr-dichtheid (voorspelde) 2,01 ± 0,1 g/cm3 Temp: 20 ° C; Druk op: 760 Torr PKA (voorspeld) 12,55 ± 0,40 meest zure temperatuur: 25 ° C Andere namen en identificatiegegevens Canonical Smiles O = C1N = C2OC3C (O) C (OC3N2C = C1) CO ISOMERIC SMILES O [C@H] 1 [C@] 2 ([C@] (N3C (N3C (N3C (O2) = Nc (= o) c = c3) (o [c @@ h] 1co) [h]) [h] in ...
